C30H30N4O3S — CID 123369918
tert-butyl 4-[4-[3-(1H-indol-2-ylmethylidene)-2-oxo-1H-indol-5-yl]-1,3-thiazol-2-yl]piperidine-1-carboxylate (PubChem CID 123369918) has the molecular formula C30H30N4O3S and a molecular weight of 526.66 g/mol. Its IUPAC name is tert-butyl 4-[4-[3-(1H-indol-2-ylmethylidene)-2-oxo-1H-indol-5-yl]-1,3-thiazol-2-yl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[4-[3-(1H-indol-2-ylmethylidene)-2-oxo-1H-indol-5-yl]-1,3-thiazol-2-yl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 123369918 |
| Molecular Formula | C30H30N4O3S |
| Molecular Weight | 526.66 g/mol |
| Exact Mass | 526.20 |
| IUPAC Name | tert-butyl 4-[4-[3-(1H-indol-2-ylmethylidene)-2-oxo-1H-indol-5-yl]-1,3-thiazol-2-yl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(c2nc(-c3ccc4c(c3)C(=Cc3cc5ccccc5[nH]3)C(=O)N4)cs2)CC1 |
| InChI | InChI=1S/C30H30N4O3S/c1-30(2,3)37-29(36)34-12-10-18(11-13-34)28-33-26(17-38-28)20-8-9-25-22(15-20)23(27(35)32-25)16-21-14-19-6-4-5-7-24(19)31-21/h4-9,14-18,31H,10-13H2,1-3H3,(H,32,35) |
| InChIKey | KNPCLQQASJITRK-UHFFFAOYSA-N |
| XLogP | 6.90 |
| TPSA | 87.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.66 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|