C20H31NO7 — CID 163625520
[(1R)-4-acetyloxy-5-amino-6-ethoxy-7-hydroxy-7-methoxy-1-phenylheptyl] acetate (PubChem CID 163625520) has the molecular formula C20H31NO7 and a molecular weight of 397.47 g/mol. Its IUPAC name is [(1R)-4-acetyloxy-5-amino-6-ethoxy-7-hydroxy-7-methoxy-1-phenylheptyl] acetate.
| Compound Name | [(1R)-4-acetyloxy-5-amino-6-ethoxy-7-hydroxy-7-methoxy-1-phenylheptyl] acetate |
|---|---|
| PubChem CID | 163625520 |
| Molecular Formula | C20H31NO7 |
| Molecular Weight | 397.47 g/mol |
| Exact Mass | 397.21 |
| IUPAC Name | [(1R)-4-acetyloxy-5-amino-6-ethoxy-7-hydroxy-7-methoxy-1-phenylheptyl] acetate |
| SMILES | CCOC(C(O)OC)C(N)C(CC[C@@H](OC(C)=O)c1ccccc1)OC(C)=O |
| InChI | InChI=1S/C20H31NO7/c1-5-26-19(20(24)25-4)18(21)17(28-14(3)23)12-11-16(27-13(2)22)15-9-7-6-8-10-15/h6-10,16-20,24H,5,11-12,21H2,1-4H3/t16-,17?,18?,19?,20?/m1/s1 |
| InChIKey | HRQYDAAATKFGOU-PISSXIKFSA-N |
| XLogP | 1.70 |
| TPSA | 117.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.47 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|