C7H10I2O3 — CID 163630448
3-ethyl-4,5-diiodo-2,7-dioxabicyclo[4.1.0]heptan-3-ol (PubChem CID 163630448) has the molecular formula C7H10I2O3 and a molecular weight of 395.96 g/mol. Its IUPAC name is 3-ethyl-4,5-diiodo-2,7-dioxabicyclo[4.1.0]heptan-3-ol.
| Compound Name | 3-ethyl-4,5-diiodo-2,7-dioxabicyclo[4.1.0]heptan-3-ol |
|---|---|
| PubChem CID | 163630448 |
| Molecular Formula | C7H10I2O3 |
| Molecular Weight | 395.96 g/mol |
| Exact Mass | 395.87 |
| IUPAC Name | 3-ethyl-4,5-diiodo-2,7-dioxabicyclo[4.1.0]heptan-3-ol |
| SMILES | CCC1(O)OC2OC2C(I)C1I |
| InChI | InChI=1S/C7H10I2O3/c1-2-7(10)5(9)3(8)4-6(11-4)12-7/h3-6,10H,2H2,1H3 |
| InChIKey | HVPNHSARPPHCEO-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.96 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|