C13H17NO2 — CID 163631578
2-methyl-1,3,3a,4,5,9b-hexahydrobenzo[de]isoquinoline-1,3-diol (PubChem CID 163631578) has the molecular formula C13H17NO2 and a molecular weight of 219.28 g/mol. Its IUPAC name is 2-methyl-1,3,3a,4,5,9b-hexahydrobenzo[de]isoquinoline-1,3-diol.
| Compound Name | 2-methyl-1,3,3a,4,5,9b-hexahydrobenzo[de]isoquinoline-1,3-diol |
|---|---|
| PubChem CID | 163631578 |
| Molecular Formula | C13H17NO2 |
| Molecular Weight | 219.28 g/mol |
| Exact Mass | 219.13 |
| IUPAC Name | 2-methyl-1,3,3a,4,5,9b-hexahydrobenzo[de]isoquinoline-1,3-diol |
| SMILES | CN1C(O)C2=CC=CC3=CCCC(C32)C1O |
| InChI | InChI=1S/C13H17NO2/c1-14-12(15)9-6-2-4-8-5-3-7-10(11(8)9)13(14)16/h2,4-6,10-13,15-16H,3,7H2,1H3 |
| InChIKey | HWNRZNGDQVBLNO-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.28 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |