C27H27N3O3 — CID 163637765
5-amino-1-(cyclohexylamino)-4-(3-methoxyanilino)anthracene-9,10-dione (PubChem CID 163637765) has the molecular formula C27H27N3O3 and a molecular weight of 441.53 g/mol. Its IUPAC name is 5-amino-1-(cyclohexylamino)-4-(3-methoxyanilino)anthracene-9,10-dione.
| Compound Name | 5-amino-1-(cyclohexylamino)-4-(3-methoxyanilino)anthracene-9,10-dione |
|---|---|
| PubChem CID | 163637765 |
| Molecular Formula | C27H27N3O3 |
| Molecular Weight | 441.53 g/mol |
| Exact Mass | 441.21 |
| IUPAC Name | 5-amino-1-(cyclohexylamino)-4-(3-methoxyanilino)anthracene-9,10-dione |
| SMILES | COc1cccc(Nc2ccc(NC3CCCCC3)c3c2C(=O)c2c(N)cccc2C3=O)c1 |
| InChI | InChI=1S/C27H27N3O3/c1-33-18-10-5-9-17(15-18)30-22-14-13-21(29-16-7-3-2-4-8-16)24-25(22)27(32)23-19(26(24)31)11-6-12-20(23)28/h5-6,9-16,29-30H,2-4,7-8,28H2,1H3 |
| InChIKey | IBQVCCWWLXSKQZ-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.53 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'anil_NH_alk_B(3)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|