C25H23N3O3 — CID 7693997
1-amino-4-(3-methoxyanilino)-2-pyrrolidin-1-ylanthracene-9,10-dione (PubChem CID 7693997) has the molecular formula C25H23N3O3 and a molecular weight of 413.48 g/mol. Its IUPAC name is 1-amino-4-(3-methoxyanilino)-2-pyrrolidin-1-ylanthracene-9,10-dione.
| Compound Name | 1-amino-4-(3-methoxyanilino)-2-pyrrolidin-1-ylanthracene-9,10-dione |
|---|---|
| PubChem CID | 7693997 |
| Molecular Formula | C25H23N3O3 |
| Molecular Weight | 413.48 g/mol |
| Exact Mass | 413.17 |
| IUPAC Name | 1-amino-4-(3-methoxyanilino)-2-pyrrolidin-1-ylanthracene-9,10-dione |
| SMILES | COc1cccc(Nc2cc(N3CCCC3)c(N)c3c2C(=O)c2ccccc2C3=O)c1 |
| InChI | InChI=1S/C25H23N3O3/c1-31-16-8-6-7-15(13-16)27-19-14-20(28-11-4-5-12-28)23(26)22-21(19)24(29)17-9-2-3-10-18(17)25(22)30/h2-3,6-10,13-14,27H,4-5,11-12,26H2,1H3 |
| InChIKey | DQUFGEYOPORWIK-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.48 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|