C17H17NO4 — CID 163642371
(2S,3R)-2-formyl-3-[[hydroxy(phenyl)methyl]amino]-3-phenylpropanoic acid (PubChem CID 163642371) has the molecular formula C17H17NO4 and a molecular weight of 299.33 g/mol. Its IUPAC name is (2S,3R)-2-formyl-3-[[hydroxy(phenyl)methyl]amino]-3-phenylpropanoic acid.
| Compound Name | (2S,3R)-2-formyl-3-[[hydroxy(phenyl)methyl]amino]-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 163642371 |
| Molecular Formula | C17H17NO4 |
| Molecular Weight | 299.33 g/mol |
| Exact Mass | 299.12 |
| IUPAC Name | (2S,3R)-2-formyl-3-[[hydroxy(phenyl)methyl]amino]-3-phenylpropanoic acid |
| SMILES | O=C[C@@H](C(=O)O)[C@@H](NC(O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C17H17NO4/c19-11-14(17(21)22)15(12-7-3-1-4-8-12)18-16(20)13-9-5-2-6-10-13/h1-11,14-16,18,20H,(H,21,22)/t14-,15+,16?/m1/s1 |
| InChIKey | IFJMIVJPNRWYJO-YSPPHNQVSA-N |
| XLogP | 1.91 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.33 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|