C51H74N6O3 — CID 163646440
5-[1,1-bis[4-hydroxy-3,5-bis(pyrrolidin-1-ylmethyl)phenyl]ethyl]-2,7-bis(pyrrolidin-1-ylmethyl)cyclohepta-1,3,6-trien-1-ol (PubChem CID 163646440) has the molecular formula C51H74N6O3 and a molecular weight of 819.19 g/mol. Its IUPAC name is 5-[1,1-bis[4-hydroxy-3,5-bis(pyrrolidin-1-ylmethyl)phenyl]ethyl]-2,7-bis(pyrrolidin-1-ylmethyl)cyclohepta-1,3,6-trien-1-ol.
| Compound Name | 5-[1,1-bis[4-hydroxy-3,5-bis(pyrrolidin-1-ylmethyl)phenyl]ethyl]-2,7-bis(pyrrolidin-1-ylmethyl)cyclohepta-1,3,6-trien-1-ol |
|---|---|
| PubChem CID | 163646440 |
| Molecular Formula | C51H74N6O3 |
| Molecular Weight | 819.19 g/mol |
| Exact Mass | 818.58 |
| IUPAC Name | 5-[1,1-bis[4-hydroxy-3,5-bis(pyrrolidin-1-ylmethyl)phenyl]ethyl]-2,7-bis(pyrrolidin-1-ylmethyl)cyclohepta-1,3,6-trien-1-ol |
| SMILES | CC(c1cc(CN2CCCC2)c(O)c(CN2CCCC2)c1)(c1cc(CN2CCCC2)c(O)c(CN2CCCC2)c1)C1C=CC(CN2CCCC2)=C(O)C(CN2CCCC2)=C1 |
| InChI | InChI=1S/C51H74N6O3/c1-51(46-29-41(35-54-20-6-7-21-54)49(59)42(30-46)36-55-22-8-9-23-55,47-31-43(37-56-24-10-11-25-56)50(60)44(32-47)38-57-26-12-13-27-57)45-15-14-39(33-52-16-2-3-17-52)48(58)40(28-45)34-53-18-4-5-19-53/h14-15,28-32,45,58-60H,2-13,16-27,33-38H2,1H3 |
| InChIKey | IIPPBLLOTWPESX-UHFFFAOYSA-N |
| XLogP | 7.90 |
| TPSA | 80.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 819.19 |
| LogP ≤ 5 | 7.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|