C23H27F4NO2 — CID 163648063
2,2,2-trifluoro-1-(3-fluorophenyl)-1-[2-methoxy-5-methyl-4-(2-methylhexylideneamino)phenyl]ethanol (PubChem CID 163648063) has the molecular formula C23H27F4NO2 and a molecular weight of 425.47 g/mol. Its IUPAC name is 2,2,2-trifluoro-1-(3-fluorophenyl)-1-[2-methoxy-5-methyl-4-(2-methylhexylideneamino)phenyl]ethanol.
| Compound Name | 2,2,2-trifluoro-1-(3-fluorophenyl)-1-[2-methoxy-5-methyl-4-(2-methylhexylideneamino)phenyl]ethanol |
|---|---|
| PubChem CID | 163648063 |
| Molecular Formula | C23H27F4NO2 |
| Molecular Weight | 425.47 g/mol |
| Exact Mass | 425.20 |
| IUPAC Name | 2,2,2-trifluoro-1-(3-fluorophenyl)-1-[2-methoxy-5-methyl-4-(2-methylhexylideneamino)phenyl]ethanol |
| SMILES | CCCCC(C)/C=N/c1cc(OC)c(C(O)(c2cccc(F)c2)C(F)(F)F)cc1C |
| InChI | InChI=1S/C23H27F4NO2/c1-5-6-8-15(2)14-28-20-13-21(30-4)19(11-16(20)3)22(29,23(25,26)27)17-9-7-10-18(24)12-17/h7,9-15,29H,5-6,8H2,1-4H3/b28-14+ |
| InChIKey | IJYGNSKRDVAESN-CCVNUDIWSA-N |
| XLogP | 6.47 |
| TPSA | 41.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.47 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|