C20H32N2O2 — CID 146907182
N'-[4-(1-cyclohexyl-1-hydroxyethyl)-5-methoxy-2-methylphenyl]-N-ethyl-N-methylmethanimidamide (PubChem CID 146907182) has the molecular formula C20H32N2O2 and a molecular weight of 332.49 g/mol. Its IUPAC name is N'-[4-(1-cyclohexyl-1-hydroxyethyl)-5-methoxy-2-methylphenyl]-N-ethyl-N-methylmethanimidamide.
| Compound Name | N'-[4-(1-cyclohexyl-1-hydroxyethyl)-5-methoxy-2-methylphenyl]-N-ethyl-N-methylmethanimidamide |
|---|---|
| PubChem CID | 146907182 |
| Molecular Formula | C20H32N2O2 |
| Molecular Weight | 332.49 g/mol |
| Exact Mass | 332.25 |
| IUPAC Name | N'-[4-(1-cyclohexyl-1-hydroxyethyl)-5-methoxy-2-methylphenyl]-N-ethyl-N-methylmethanimidamide |
| SMILES | CCN(C)/C=N/c1cc(OC)c(C(C)(O)C2CCCCC2)cc1C |
| InChI | InChI=1S/C20H32N2O2/c1-6-22(4)14-21-18-13-19(24-5)17(12-15(18)2)20(3,23)16-10-8-7-9-11-16/h12-14,16,23H,6-11H2,1-5H3/b21-14+ |
| InChIKey | AAPBYERSSJAQBW-KGENOOAVSA-N |
| XLogP | 4.40 |
| TPSA | 45.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.49 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|