C18H30N2O2 — CID 147037586
N-ethyl-N'-[4-(2-hydroxy-4-methylpentan-2-yl)-5-methoxy-2-methylphenyl]-N-methylmethanimidamide (PubChem CID 147037586) has the molecular formula C18H30N2O2 and a molecular weight of 306.45 g/mol. Its IUPAC name is N-ethyl-N'-[4-(2-hydroxy-4-methylpentan-2-yl)-5-methoxy-2-methylphenyl]-N-methylmethanimidamide.
| Compound Name | N-ethyl-N'-[4-(2-hydroxy-4-methylpentan-2-yl)-5-methoxy-2-methylphenyl]-N-methylmethanimidamide |
|---|---|
| PubChem CID | 147037586 |
| Molecular Formula | C18H30N2O2 |
| Molecular Weight | 306.45 g/mol |
| Exact Mass | 306.23 |
| IUPAC Name | N-ethyl-N'-[4-(2-hydroxy-4-methylpentan-2-yl)-5-methoxy-2-methylphenyl]-N-methylmethanimidamide |
| SMILES | CCN(C)/C=N/c1cc(OC)c(C(C)(O)CC(C)C)cc1C |
| InChI | InChI=1S/C18H30N2O2/c1-8-20(6)12-19-16-10-17(22-7)15(9-14(16)4)18(5,21)11-13(2)3/h9-10,12-13,21H,8,11H2,1-7H3/b19-12+ |
| InChIKey | AYUSDYVGKUUUKV-XDHOZWIPSA-N |
| XLogP | 3.87 |
| TPSA | 45.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.45 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|