C19H28F3N3O3 — CID 137362213
N'-[4-[(4E)-4-ethoxyimino-1,1,1-trifluoro-2-hydroxypentan-2-yl]-5-methoxy-2-methylphenyl]-N-ethyl-N-methylmethanimidamide (PubChem CID 137362213) has the molecular formula C19H28F3N3O3 and a molecular weight of 403.45 g/mol. Its IUPAC name is N'-[4-[(4E)-4-ethoxyimino-1,1,1-trifluoro-2-hydroxypentan-2-yl]-5-methoxy-2-methylphenyl]-N-ethyl-N-methylmethanimidamide.
| Compound Name | N'-[4-[(4E)-4-ethoxyimino-1,1,1-trifluoro-2-hydroxypentan-2-yl]-5-methoxy-2-methylphenyl]-N-ethyl-N-methylmethanimidamide |
|---|---|
| PubChem CID | 137362213 |
| Molecular Formula | C19H28F3N3O3 |
| Molecular Weight | 403.45 g/mol |
| Exact Mass | 403.21 |
| IUPAC Name | N'-[4-[(4E)-4-ethoxyimino-1,1,1-trifluoro-2-hydroxypentan-2-yl]-5-methoxy-2-methylphenyl]-N-ethyl-N-methylmethanimidamide |
| SMILES | CCO/N=C(\C)CC(O)(c1cc(C)c(/N=C/N(C)CC)cc1OC)C(F)(F)F |
| InChI | InChI=1S/C19H28F3N3O3/c1-7-25(5)12-23-16-10-17(27-6)15(9-13(16)3)18(26,19(20,21)22)11-14(4)24-28-8-2/h9-10,12,26H,7-8,11H2,1-6H3/b23-12+,24-14+ |
| InChIKey | QFSIVHPHAXMIRT-GKZLBNLFSA-N |
| XLogP | 4.17 |
| TPSA | 66.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.45 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|