C23H19N7OS — CID 163648395
4-[[(15R)-15-ethynyl-13-oxo-11-thia-6,14,17-triazatetracyclo[8.8.0.02,7.012,18]octadeca-1(10),2(7),3,5,8,12(18)-hexaen-5-yl]amino]-1,2-dimethyl-2H-pyrimidine-5-carbonitrile (PubChem CID 163648395) has the molecular formula C23H19N7OS and a molecular weight of 441.52 g/mol. Its IUPAC name is 4-[[(15R)-15-ethynyl-13-oxo-11-thia-6,14,17-triazatetracyclo[8.8.0.02,7.012,18]octadeca-1(10),2(7),3,5,8,12(18)-hexaen-5-yl]amino]-1,2-dimethyl-2H-pyrimidine-5-carbonitrile.
| Compound Name | 4-[[(15R)-15-ethynyl-13-oxo-11-thia-6,14,17-triazatetracyclo[8.8.0.02,7.012,18]octadeca-1(10),2(7),3,5,8,12(18)-hexaen-5-yl]amino]-1,2-dimethyl-2H-pyrimidine-5-carbonitrile |
|---|---|
| PubChem CID | 163648395 |
| Molecular Formula | C23H19N7OS |
| Molecular Weight | 441.52 g/mol |
| Exact Mass | 441.14 |
| IUPAC Name | 4-[[(15R)-15-ethynyl-13-oxo-11-thia-6,14,17-triazatetracyclo[8.8.0.02,7.012,18]octadeca-1(10),2(7),3,5,8,12(18)-hexaen-5-yl]amino]-1,2-dimethyl-2H-pyrimidine-5-carbonitrile |
| SMILES | C#C[C@@H]1CNc2c(sc3ccc4nc(NC5=NC(C)N(C)C=C5C#N)ccc4c23)C(=O)N1 |
| InChI | InChI=1S/C23H19N7OS/c1-4-14-10-25-20-19-15-5-8-18(29-22-13(9-24)11-30(3)12(2)26-22)28-16(15)6-7-17(19)32-21(20)23(31)27-14/h1,5-8,11-12,14,25H,10H2,2-3H3,(H,27,31)(H,26,28,29)/t12?,14-/m1/s1 |
| InChIKey | IKEBVPSXIFCMIN-TYZXPVIJSA-N |
| XLogP | 3.12 |
| TPSA | 105.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.52 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|