About [(2S)-1-amino-3-methylbutan-2-yl] nitrite
[(2S)-1-amino-3-methylbutan-2-yl] nitrite (PubChem CID 163649506) has the molecular formula C5H12N2O2
and a molecular weight of 132.16 g/mol. Its IUPAC name is [(2S)-1-amino-3-methylbutan-2-yl] nitrite.
Molecular Properties
| Compound Name | [(2S)-1-amino-3-methylbutan-2-yl] nitrite |
| PubChem CID | 163649506 |
| Molecular Formula | C5H12N2O2 |
| Molecular Weight | 132.16 g/mol |
| Exact Mass | 132.09 |
| IUPAC Name | [(2S)-1-amino-3-methylbutan-2-yl] nitrite |
| SMILES | CC(C)[C@@H](CN)ON=O |
| InChI | InChI=1S/C5H12N2O2/c1-4(2)5(3-6)9-7-8/h4-5H,3,6H2,1-2H3/t5-/m1/s1 |
| InChIKey | ILAVTIPNHRGCAY-RXMQYKEDSA-N |
| XLogP | 0.67 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 132.16 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [(2S)-1-amino-3-methylbutan-2-yl] nitrite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2S)-1-amino-3-methylbutan-2-yl] nitrite?
The IUPAC name of [(2S)-1-amino-3-methylbutan-2-yl] nitrite (CID 163649506) is [(2S)-1-amino-3-methylbutan-2-yl] nitrite.
What is the SMILES notation for [(2S)-1-amino-3-methylbutan-2-yl] nitrite?
The canonical SMILES for [(2S)-1-amino-3-methylbutan-2-yl] nitrite is CC(C)[C@@H](CN)ON=O.
What is the InChIKey of [(2S)-1-amino-3-methylbutan-2-yl] nitrite?
The InChIKey is ILAVTIPNHRGCAY-RXMQYKEDSA-N. The full InChI is InChI=1S/C5H12N2O2/c1-4(2)5(3-6)9-7-8/h4-5H,3,6H2,1-2H3/t5-/m1/s1.
What are the key properties of [(2S)-1-amino-3-methylbutan-2-yl] nitrite?
[(2S)-1-amino-3-methylbutan-2-yl] nitrite has a molecular weight of 132.16 g/mol, XLogP of 0.67, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(2S)-1-amino-3-methylbutan-2-yl] nitrite is sourced from PubChem (CID 163649506), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).