About 1-oxobutan-2-yl nitrite
1-oxobutan-2-yl nitrite (PubChem CID 59256243) has the molecular formula C4H7NO3
and a molecular weight of 117.10 g/mol. Its IUPAC name is 1-oxobutan-2-yl nitrite.
Molecular Properties
| Compound Name | 1-oxobutan-2-yl nitrite |
| PubChem CID | 59256243 |
| Molecular Formula | C4H7NO3 |
| Molecular Weight | 117.10 g/mol |
| Exact Mass | 117.04 |
| IUPAC Name | 1-oxobutan-2-yl nitrite |
| SMILES | CCC(C=O)ON=O |
| InChI | InChI=1S/C4H7NO3/c1-2-4(3-6)8-5-7/h3-4H,2H2,1H3 |
| InChIKey | BMMCOKLBIJPGSF-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 55.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 117.10 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-oxobutan-2-yl nitrite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-oxobutan-2-yl nitrite?
The IUPAC name of 1-oxobutan-2-yl nitrite (CID 59256243) is 1-oxobutan-2-yl nitrite.
What is the SMILES notation for 1-oxobutan-2-yl nitrite?
The canonical SMILES for 1-oxobutan-2-yl nitrite is CCC(C=O)ON=O.
What is the InChIKey of 1-oxobutan-2-yl nitrite?
The InChIKey is BMMCOKLBIJPGSF-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H7NO3/c1-2-4(3-6)8-5-7/h3-4H,2H2,1H3.
What are the key properties of 1-oxobutan-2-yl nitrite?
1-oxobutan-2-yl nitrite has a molecular weight of 117.10 g/mol, XLogP of 0.66, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-oxobutan-2-yl nitrite is sourced from PubChem (CID 59256243), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).