C14H21N — CID 163650090
4,5-dimethyl-5-propyl-4,4a-dihydro-3H-quinoline (PubChem CID 163650090) has the molecular formula C14H21N and a molecular weight of 203.33 g/mol. Its IUPAC name is 4,5-dimethyl-5-propyl-4,4a-dihydro-3H-quinoline.
| Compound Name | 4,5-dimethyl-5-propyl-4,4a-dihydro-3H-quinoline |
|---|---|
| PubChem CID | 163650090 |
| Molecular Formula | C14H21N |
| Molecular Weight | 203.33 g/mol |
| Exact Mass | 203.17 |
| IUPAC Name | 4,5-dimethyl-5-propyl-4,4a-dihydro-3H-quinoline |
| SMILES | CCCC1(C)C=CC=C2N=CCC(C)C21 |
| InChI | InChI=1S/C14H21N/c1-4-8-14(3)9-5-6-12-13(14)11(2)7-10-15-12/h5-6,9-11,13H,4,7-8H2,1-3H3 |
| InChIKey | ILNPYPNSLJPSRK-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.33 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |