C39H47N11O2 — CID 163650387
1-(4-nitrophenyl)-4-pyridin-2-ylpiperazine;1-pyridin-2-ylpiperazine;4-(4-pyridin-2-ylpiperazin-1-yl)aniline (PubChem CID 163650387) has the molecular formula C39H47N11O2 and a molecular weight of 701.88 g/mol. Its IUPAC name is 1-(4-nitrophenyl)-4-pyridin-2-ylpiperazine;1-pyridin-2-ylpiperazine;4-(4-pyridin-2-ylpiperazin-1-yl)aniline.
| Compound Name | 1-(4-nitrophenyl)-4-pyridin-2-ylpiperazine;1-pyridin-2-ylpiperazine;4-(4-pyridin-2-ylpiperazin-1-yl)aniline |
|---|---|
| PubChem CID | 163650387 |
| Molecular Formula | C39H47N11O2 |
| Molecular Weight | 701.88 g/mol |
| Exact Mass | 701.39 |
| IUPAC Name | 1-(4-nitrophenyl)-4-pyridin-2-ylpiperazine;1-pyridin-2-ylpiperazine;4-(4-pyridin-2-ylpiperazin-1-yl)aniline |
| SMILES | Nc1ccc(N2CCN(c3ccccn3)CC2)cc1.O=[N+]([O-])c1ccc(N2CCN(c3ccccn3)CC2)cc1.c1ccc(N2CCNCC2)nc1 |
| InChI | InChI=1S/C15H16N4O2.C15H18N4.C9H13N3/c20-19(21)14-6-4-13(5-7-14)17-9-11-18(12-10-17)15-3-1-2-8-16-15;16-13-4-6-14(7-5-13)18-9-11-19(12-10-18)15-3-1-2-8-17-15;1-2-4-11-9(3-1)12-7-5-10-6-8-12/h1-8H,9-12H2;1-8H,9-12,16H2;1-4,10H,5-8H2 |
| InChIKey | ILTRZYMXPKECAN-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 136.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 701.88 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|