C25H34O4 — CID 163653111
6-(8,8-dimethyl-3,4,9,10-tetrahydro-2H-pyrano[2,3-h]chromen-3-yl)-3-pentoxycyclohexa-1,3-dien-1-ol (PubChem CID 163653111) has the molecular formula C25H34O4 and a molecular weight of 398.54 g/mol. Its IUPAC name is 6-(8,8-dimethyl-3,4,9,10-tetrahydro-2H-pyrano[2,3-h]chromen-3-yl)-3-pentoxycyclohexa-1,3-dien-1-ol.
| Compound Name | 6-(8,8-dimethyl-3,4,9,10-tetrahydro-2H-pyrano[2,3-h]chromen-3-yl)-3-pentoxycyclohexa-1,3-dien-1-ol |
|---|---|
| PubChem CID | 163653111 |
| Molecular Formula | C25H34O4 |
| Molecular Weight | 398.54 g/mol |
| Exact Mass | 398.25 |
| IUPAC Name | 6-(8,8-dimethyl-3,4,9,10-tetrahydro-2H-pyrano[2,3-h]chromen-3-yl)-3-pentoxycyclohexa-1,3-dien-1-ol |
| SMILES | CCCCCOC1=CCC(C2COc3c(ccc4c3CCC(C)(C)O4)C2)C(O)=C1 |
| InChI | InChI=1S/C25H34O4/c1-4-5-6-13-27-19-8-9-20(22(26)15-19)18-14-17-7-10-23-21(24(17)28-16-18)11-12-25(2,3)29-23/h7-8,10,15,18,20,26H,4-6,9,11-14,16H2,1-3H3 |
| InChIKey | INXHLIWVQMGAML-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.54 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|