About 9H-fluoren-9-ylmethyl (2S)-2-[2-(2-hydroxyethoxy)ethylcarbamoyl]-4-oxopyrrolidine-1-carboxylate
9H-fluoren-9-ylmethyl (2S)-2-[2-(2-hydroxyethoxy)ethylcarbamoyl]-4-oxopyrrolidine-1-carboxylate (PubChem CID 163654745) has the molecular formula C24H26N2O6
and a molecular weight of 438.48 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl (2S)-2-[2-(2-hydroxyethoxy)ethylcarbamoyl]-4-oxopyrrolidine-1-carboxylate.
Molecular Properties
| Compound Name | 9H-fluoren-9-ylmethyl (2S)-2-[2-(2-hydroxyethoxy)ethylcarbamoyl]-4-oxopyrrolidine-1-carboxylate |
| PubChem CID | 163654745 |
| Molecular Formula | C24H26N2O6 |
| Molecular Weight | 438.48 g/mol |
| Exact Mass | 438.18 |
| IUPAC Name | 9H-fluoren-9-ylmethyl (2S)-2-[2-(2-hydroxyethoxy)ethylcarbamoyl]-4-oxopyrrolidine-1-carboxylate |
| SMILES | O=C1C[C@@H](C(=O)NCCOCCO)N(C(=O)OCC2c3ccccc3-c3ccccc32)C1 |
| InChI | InChI=1S/C24H26N2O6/c27-10-12-31-11-9-25-23(29)22-13-16(28)14-26(22)24(30)32-15-21-19-7-3-1-5-17(19)18-6-2-4-8-20(18)21/h1-8,21-22,27H,9-15H2,(H,25,29)/t22-/m0/s1 |
| InChIKey | IPFLUQMKNUEAHW-QFIPXVFZSA-N |
| XLogP | 1.70 |
| TPSA | 105.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 438.48 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 9H-fluoren-9-ylmethyl (2S)-2-[2-(2-hydroxyethoxy)ethylcarbamoyl]-4-oxopyrrolidine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9H-fluoren-9-ylmethyl (2S)-2-[2-(2-hydroxyethoxy)ethylcarbamoyl]-4-oxopyrrolidine-1-carboxylate?
The IUPAC name of 9H-fluoren-9-ylmethyl (2S)-2-[2-(2-hydroxyethoxy)ethylcarbamoyl]-4-oxopyrrolidine-1-carboxylate (CID 163654745) is 9H-fluoren-9-ylmethyl (2S)-2-[2-(2-hydroxyethoxy)ethylcarbamoyl]-4-oxopyrrolidine-1-carboxylate.
What is the SMILES notation for 9H-fluoren-9-ylmethyl (2S)-2-[2-(2-hydroxyethoxy)ethylcarbamoyl]-4-oxopyrrolidine-1-carboxylate?
The canonical SMILES for 9H-fluoren-9-ylmethyl (2S)-2-[2-(2-hydroxyethoxy)ethylcarbamoyl]-4-oxopyrrolidine-1-carboxylate is O=C1C[C@@H](C(=O)NCCOCCO)N(C(=O)OCC2c3ccccc3-c3ccccc32)C1.
What is the InChIKey of 9H-fluoren-9-ylmethyl (2S)-2-[2-(2-hydroxyethoxy)ethylcarbamoyl]-4-oxopyrrolidine-1-carboxylate?
The InChIKey is IPFLUQMKNUEAHW-QFIPXVFZSA-N. The full InChI is InChI=1S/C24H26N2O6/c27-10-12-31-11-9-25-23(29)22-13-16(28)14-26(22)24(30)32-15-21-19-7-3-1-5-17(19)18-6-2-4-8-20(18)21/h1-8,21-22,27H,9-15H2,(H,25,29)/t22-/m0/s1.
What are the key properties of 9H-fluoren-9-ylmethyl (2S)-2-[2-(2-hydroxyethoxy)ethylcarbamoyl]-4-oxopyrrolidine-1-carboxylate?
9H-fluoren-9-ylmethyl (2S)-2-[2-(2-hydroxyethoxy)ethylcarbamoyl]-4-oxopyrrolidine-1-carboxylate has a molecular weight of 438.48 g/mol, XLogP of 1.70, 8 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 9H-fluoren-9-ylmethyl (2S)-2-[2-(2-hydroxyethoxy)ethylcarbamoyl]-4-oxopyrrolidine-1-carboxylate is sourced from PubChem (CID 163654745), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).