C27H35N3O6 — CID 175087548
9H-fluoren-9-ylmethyl 1-[2-[2-(2-hydroxyethoxy)ethoxy]ethylcarbamoylamino]piperidine-4-carboxylate (PubChem CID 175087548) has the molecular formula C27H35N3O6 and a molecular weight of 497.59 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl 1-[2-[2-(2-hydroxyethoxy)ethoxy]ethylcarbamoylamino]piperidine-4-carboxylate.
| Compound Name | 9H-fluoren-9-ylmethyl 1-[2-[2-(2-hydroxyethoxy)ethoxy]ethylcarbamoylamino]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 175087548 |
| Molecular Formula | C27H35N3O6 |
| Molecular Weight | 497.59 g/mol |
| Exact Mass | 497.25 |
| IUPAC Name | 9H-fluoren-9-ylmethyl 1-[2-[2-(2-hydroxyethoxy)ethoxy]ethylcarbamoylamino]piperidine-4-carboxylate |
| SMILES | O=C(NCCOCCOCCO)NN1CCC(C(=O)OCC2c3ccccc3-c3ccccc32)CC1 |
| InChI | InChI=1S/C27H35N3O6/c31-14-16-35-18-17-34-15-11-28-27(33)29-30-12-9-20(10-13-30)26(32)36-19-25-23-7-3-1-5-21(23)22-6-2-4-8-24(22)25/h1-8,20,25,31H,9-19H2,(H2,28,29,33) |
| InChIKey | FQJRXEJEGXOMAH-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 109.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.59 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|