C18H19NO2S — CID 163655428
4-[(2-ethyl-6-isocyanatophenyl)methoxy]-2,5-dimethylbenzenethiol (PubChem CID 163655428) has the molecular formula C18H19NO2S and a molecular weight of 313.42 g/mol. Its IUPAC name is 4-[(2-ethyl-6-isocyanatophenyl)methoxy]-2,5-dimethylbenzenethiol.
| Compound Name | 4-[(2-ethyl-6-isocyanatophenyl)methoxy]-2,5-dimethylbenzenethiol |
|---|---|
| PubChem CID | 163655428 |
| Molecular Formula | C18H19NO2S |
| Molecular Weight | 313.42 g/mol |
| Exact Mass | 313.11 |
| IUPAC Name | 4-[(2-ethyl-6-isocyanatophenyl)methoxy]-2,5-dimethylbenzenethiol |
| SMILES | CCc1cccc(N=C=O)c1COc1cc(C)c(S)cc1C |
| InChI | InChI=1S/C18H19NO2S/c1-4-14-6-5-7-16(19-11-20)15(14)10-21-17-8-13(3)18(22)9-12(17)2/h5-9,22H,4,10H2,1-3H3 |
| InChIKey | IPUVZNNOIJBQQS-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 38.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.42 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|