C20H25N4O2+ — CID 163655745
4-[(1-methylcyclopropyl)methoxy]-2-(3-methylidenecyclohexa-1,5-dien-1-yl)-5-piperazin-1-ylpyridazin-3-one (PubChem CID 163655745) has the molecular formula C20H25N4O2+ and a molecular weight of 353.45 g/mol. Its IUPAC name is 4-[(1-methylcyclopropyl)methoxy]-2-(3-methylidenecyclohexa-1,5-dien-1-yl)-5-piperazin-1-ylpyridazin-3-one.
| Compound Name | 4-[(1-methylcyclopropyl)methoxy]-2-(3-methylidenecyclohexa-1,5-dien-1-yl)-5-piperazin-1-ylpyridazin-3-one |
|---|---|
| PubChem CID | 163655745 |
| Molecular Formula | C20H25N4O2+ |
| Molecular Weight | 353.45 g/mol |
| Exact Mass | 353.20 |
| IUPAC Name | 4-[(1-methylcyclopropyl)methoxy]-2-(3-methylidenecyclohexa-1,5-dien-1-yl)-5-piperazin-1-ylpyridazin-3-one |
| SMILES | C=C1C=C(n2ncc(N3CCNCC3)c(OCC3(C)CC3)c2=O)C=C[CH+]1 |
| InChI | InChI=1S/C20H25N4O2/c1-15-4-3-5-16(12-15)24-19(25)18(26-14-20(2)6-7-20)17(13-22-24)23-10-8-21-9-11-23/h3-5,12-13,21H,1,6-11,14H2,2H3/q+1 |
| InChIKey | IQBCFVYLRKLLRT-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 59.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.45 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|