C25H36N4O8S3 — CID 163659910
4-amino-3-[[5-[cyclopropyl(ethyl)sulfamoyl]-4-hydroxythiophen-3-yl]amino]-4-[1-(4,5-dimethylfuran-2-yl)-2-methylpropyl]azaniumylidene-1-ethoxy-1-oxobut-2-ene-2-sulfinate (PubChem CID 163659910) has the molecular formula C25H36N4O8S3 and a molecular weight of 616.78 g/mol. Its IUPAC name is 4-amino-3-[[5-[cyclopropyl(ethyl)sulfamoyl]-4-hydroxythiophen-3-yl]amino]-4-[1-(4,5-dimethylfuran-2-yl)-2-methylpropyl]azaniumylidene-1-ethoxy-1-oxobut-2-ene-2-sulfinate.
| Compound Name | 4-amino-3-[[5-[cyclopropyl(ethyl)sulfamoyl]-4-hydroxythiophen-3-yl]amino]-4-[1-(4,5-dimethylfuran-2-yl)-2-methylpropyl]azaniumylidene-1-ethoxy-1-oxobut-2-ene-2-sulfinate |
|---|---|
| PubChem CID | 163659910 |
| Molecular Formula | C25H36N4O8S3 |
| Molecular Weight | 616.78 g/mol |
| Exact Mass | 616.17 |
| IUPAC Name | 4-amino-3-[[5-[cyclopropyl(ethyl)sulfamoyl]-4-hydroxythiophen-3-yl]amino]-4-[1-(4,5-dimethylfuran-2-yl)-2-methylpropyl]azaniumylidene-1-ethoxy-1-oxobut-2-ene-2-sulfinate |
| SMILES | CCOC(=O)C(=C(Nc1csc(S(=O)(=O)N(CC)C2CC2)c1O)/C(N)=[NH+]/C(c1cc(C)c(C)o1)C(C)C)S(=O)[O-] |
| InChI | InChI=1S/C25H36N4O8S3/c1-7-29(16-9-10-16)40(34,35)25-21(30)17(12-38-25)27-20(22(39(32)33)24(31)36-8-2)23(26)28-19(13(3)4)18-11-14(5)15(6)37-18/h11-13,16,19,27,30H,7-10H2,1-6H3,(H2,26,28)(H,32,33) |
| InChIKey | RUUAVBAGRHRHLX-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 189.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.78 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'thiophene_hydroxy(28)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|