C8H14N2O3S2 — CID 20795777
4-amino-N,N-diethyl-3-hydroxythiophene-2-sulfonamide (PubChem CID 20795777) has the molecular formula C8H14N2O3S2 and a molecular weight of 250.34 g/mol. Its IUPAC name is 4-amino-N,N-diethyl-3-hydroxythiophene-2-sulfonamide.
| Compound Name | 4-amino-N,N-diethyl-3-hydroxythiophene-2-sulfonamide |
|---|---|
| PubChem CID | 20795777 |
| Molecular Formula | C8H14N2O3S2 |
| Molecular Weight | 250.34 g/mol |
| Exact Mass | 250.04 |
| IUPAC Name | 4-amino-N,N-diethyl-3-hydroxythiophene-2-sulfonamide |
| SMILES | CCN(CC)S(=O)(=O)c1scc(N)c1O |
| InChI | InChI=1S/C8H14N2O3S2/c1-3-10(4-2)15(12,13)8-7(11)6(9)5-14-8/h5,11H,3-4,9H2,1-2H3 |
| InChIKey | OJWCUNDZTZBFHH-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 83.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.34 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiophene_hydroxy(28)', 'substructure': 'N/A'} |
|---|