C11H18ClNO3S2 — CID 58591545
5-chloro-N,N-diethyl-3-hydroxy-4-propan-2-ylthiophene-2-sulfonamide (PubChem CID 58591545) has the molecular formula C11H18ClNO3S2 and a molecular weight of 311.86 g/mol. Its IUPAC name is 5-chloro-N,N-diethyl-3-hydroxy-4-propan-2-ylthiophene-2-sulfonamide.
| Compound Name | 5-chloro-N,N-diethyl-3-hydroxy-4-propan-2-ylthiophene-2-sulfonamide |
|---|---|
| PubChem CID | 58591545 |
| Molecular Formula | C11H18ClNO3S2 |
| Molecular Weight | 311.86 g/mol |
| Exact Mass | 311.04 |
| IUPAC Name | 5-chloro-N,N-diethyl-3-hydroxy-4-propan-2-ylthiophene-2-sulfonamide |
| SMILES | CCN(CC)S(=O)(=O)c1sc(Cl)c(C(C)C)c1O |
| InChI | InChI=1S/C11H18ClNO3S2/c1-5-13(6-2)18(15,16)11-9(14)8(7(3)4)10(12)17-11/h7,14H,5-6H2,1-4H3 |
| InChIKey | KPARFTDEJYMUGQ-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.86 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiophene_hydroxy(28)', 'substructure': 'N/A'} |
|---|