C11H15ClN4O5S4 — CID 59654504
3-[(2-chlorothiophen-3-yl)sulfamoylamino]-N,N-diethyl-4-hydroxy-1,2-thiazole-5-sulfonamide (PubChem CID 59654504) has the molecular formula C11H15ClN4O5S4 and a molecular weight of 446.99 g/mol. Its IUPAC name is 3-[(2-chlorothiophen-3-yl)sulfamoylamino]-N,N-diethyl-4-hydroxy-1,2-thiazole-5-sulfonamide.
| Compound Name | 3-[(2-chlorothiophen-3-yl)sulfamoylamino]-N,N-diethyl-4-hydroxy-1,2-thiazole-5-sulfonamide |
|---|---|
| PubChem CID | 59654504 |
| Molecular Formula | C11H15ClN4O5S4 |
| Molecular Weight | 446.99 g/mol |
| Exact Mass | 445.96 |
| IUPAC Name | 3-[(2-chlorothiophen-3-yl)sulfamoylamino]-N,N-diethyl-4-hydroxy-1,2-thiazole-5-sulfonamide |
| SMILES | CCN(CC)S(=O)(=O)c1snc(NS(=O)(=O)Nc2ccsc2Cl)c1O |
| InChI | InChI=1S/C11H15ClN4O5S4/c1-3-16(4-2)24(18,19)11-8(17)10(13-23-11)15-25(20,21)14-7-5-6-22-9(7)12/h5-6,14,17H,3-4H2,1-2H3,(H,13,15) |
| InChIKey | SGZKHWRUCGQPLX-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 128.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.99 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'sulfonamide_E(2)', 'substructure': 'N/A'} |
|---|