C14H21N5O4S2 — CID 163537625
1-[5-(diethylsulfamoyl)-4-hydroxy-1-methylpyrazol-3-yl]-3-(2-methylthiophen-3-yl)urea (PubChem CID 163537625) has the molecular formula C14H21N5O4S2 and a molecular weight of 387.49 g/mol. Its IUPAC name is 1-[5-(diethylsulfamoyl)-4-hydroxy-1-methylpyrazol-3-yl]-3-(2-methylthiophen-3-yl)urea.
| Compound Name | 1-[5-(diethylsulfamoyl)-4-hydroxy-1-methylpyrazol-3-yl]-3-(2-methylthiophen-3-yl)urea |
|---|---|
| PubChem CID | 163537625 |
| Molecular Formula | C14H21N5O4S2 |
| Molecular Weight | 387.49 g/mol |
| Exact Mass | 387.10 |
| IUPAC Name | 1-[5-(diethylsulfamoyl)-4-hydroxy-1-methylpyrazol-3-yl]-3-(2-methylthiophen-3-yl)urea |
| SMILES | CCN(CC)S(=O)(=O)c1c(O)c(NC(=O)Nc2ccsc2C)nn1C |
| InChI | InChI=1S/C14H21N5O4S2/c1-5-19(6-2)25(22,23)13-11(20)12(17-18(13)4)16-14(21)15-10-7-8-24-9(10)3/h7-8,20H,5-6H2,1-4H3,(H2,15,16,17,21) |
| InChIKey | DYISOQWEQNASTR-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 116.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.49 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |