C21H33N5O4S2 — CID 163616522
1-N'-[5-(diethylsulfamoyl)-4-hydroxythiophen-3-yl]-2-N'-[(1R)-2-methyl-1-(4-propan-2-ylfuran-2-yl)propyl]ethanediimidamide (PubChem CID 163616522) has the molecular formula C21H33N5O4S2 and a molecular weight of 483.66 g/mol. Its IUPAC name is 1-N'-[5-(diethylsulfamoyl)-4-hydroxythiophen-3-yl]-2-N'-[(1R)-2-methyl-1-(4-propan-2-ylfuran-2-yl)propyl]ethanediimidamide.
| Compound Name | 1-N'-[5-(diethylsulfamoyl)-4-hydroxythiophen-3-yl]-2-N'-[(1R)-2-methyl-1-(4-propan-2-ylfuran-2-yl)propyl]ethanediimidamide |
|---|---|
| PubChem CID | 163616522 |
| Molecular Formula | C21H33N5O4S2 |
| Molecular Weight | 483.66 g/mol |
| Exact Mass | 483.20 |
| IUPAC Name | 1-N'-[5-(diethylsulfamoyl)-4-hydroxythiophen-3-yl]-2-N'-[(1R)-2-methyl-1-(4-propan-2-ylfuran-2-yl)propyl]ethanediimidamide |
| SMILES | CCN(CC)S(=O)(=O)c1scc(/N=C(N)/C(N)=N/[C@@H](c2cc(C(C)C)co2)C(C)C)c1O |
| InChI | InChI=1S/C21H33N5O4S2/c1-7-26(8-2)32(28,29)21-18(27)15(11-31-21)24-19(22)20(23)25-17(13(5)6)16-9-14(10-30-16)12(3)4/h9-13,17,27H,7-8H2,1-6H3,(H2,22,24)(H2,23,25)/t17-/m1/s1 |
| InChIKey | HKLVJYFAVFQNIS-QGZVFWFLSA-N |
| XLogP | 3.94 |
| TPSA | 147.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.66 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiophene_hydroxy(28)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|