C21H29N5O5S3 — CID 173479414
N,N-diethyl-3-hydroxy-4-[[4-[(1R)-2-methyl-1-(4-propan-2-ylfuran-2-yl)prop-2-enyl]imino-1-oxido-1,2,5-thiadiazol-1-ium-3-yl]amino]thiophene-2-sulfonamide (PubChem CID 173479414) has the molecular formula C21H29N5O5S3 and a molecular weight of 527.69 g/mol. Its IUPAC name is N,N-diethyl-3-hydroxy-4-[[4-[(1R)-2-methyl-1-(4-propan-2-ylfuran-2-yl)prop-2-enyl]imino-1-oxido-1,2,5-thiadiazol-1-ium-3-yl]amino]thiophene-2-sulfonamide.
| Compound Name | N,N-diethyl-3-hydroxy-4-[[4-[(1R)-2-methyl-1-(4-propan-2-ylfuran-2-yl)prop-2-enyl]imino-1-oxido-1,2,5-thiadiazol-1-ium-3-yl]amino]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 173479414 |
| Molecular Formula | C21H29N5O5S3 |
| Molecular Weight | 527.69 g/mol |
| Exact Mass | 527.13 |
| IUPAC Name | N,N-diethyl-3-hydroxy-4-[[4-[(1R)-2-methyl-1-(4-propan-2-ylfuran-2-yl)prop-2-enyl]imino-1-oxido-1,2,5-thiadiazol-1-ium-3-yl]amino]thiophene-2-sulfonamide |
| SMILES | C=C(C)[C@@H](/N=c1\[nH][s+]([O-])nc1Nc1csc(S(=O)(=O)N(CC)CC)c1O)c1cc(C(C)C)co1 |
| InChI | InChI=1S/C21H29N5O5S3/c1-7-26(8-2)34(29,30)21-18(27)15(11-32-21)22-19-20(25-33(28)24-19)23-17(13(5)6)16-9-14(10-31-16)12(3)4/h9-12,17,27H,5,7-8H2,1-4,6H3,(H,22,24)(H,23,25)/t17-,33?/m1/s1 |
| InChIKey | UUSGESLVEGSRBO-VAEGFVRCSA-N |
| XLogP | 4.61 |
| TPSA | 146.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.69 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'thiophene_hydroxy(28)', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|