C18H27N5O4S2 — CID 143077285
1-N'-[5-(diethylsulfamoyl)-4-hydroxythiophen-3-yl]-2-N'-[(1R)-1-(4-methylfuran-2-yl)propyl]ethanediimidamide (PubChem CID 143077285) has the molecular formula C18H27N5O4S2 and a molecular weight of 441.58 g/mol. Its IUPAC name is 1-N'-[5-(diethylsulfamoyl)-4-hydroxythiophen-3-yl]-2-N'-[(1R)-1-(4-methylfuran-2-yl)propyl]ethanediimidamide.
| Compound Name | 1-N'-[5-(diethylsulfamoyl)-4-hydroxythiophen-3-yl]-2-N'-[(1R)-1-(4-methylfuran-2-yl)propyl]ethanediimidamide |
|---|---|
| PubChem CID | 143077285 |
| Molecular Formula | C18H27N5O4S2 |
| Molecular Weight | 441.58 g/mol |
| Exact Mass | 441.15 |
| IUPAC Name | 1-N'-[5-(diethylsulfamoyl)-4-hydroxythiophen-3-yl]-2-N'-[(1R)-1-(4-methylfuran-2-yl)propyl]ethanediimidamide |
| SMILES | CC[C@@H](/N=C(N)/C(N)=N/c1csc(S(=O)(=O)N(CC)CC)c1O)c1cc(C)co1 |
| InChI | InChI=1S/C18H27N5O4S2/c1-5-12(14-8-11(4)9-27-14)21-16(19)17(20)22-13-10-28-18(15(13)24)29(25,26)23(6-2)7-3/h8-10,12,24H,5-7H2,1-4H3,(H2,19,21)(H2,20,22)/t12-/m1/s1 |
| InChIKey | MQVUOHGTCZWEPM-GFCCVEGCSA-N |
| XLogP | 2.88 |
| TPSA | 147.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.58 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiophene_hydroxy(28)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|