C15H24O4 — CID 163662922
(4-methylidene-5-oxooxolan-2-yl)methyl 2,2,4,4-tetramethylpentanoate (PubChem CID 163662922) has the molecular formula C15H24O4 and a molecular weight of 268.35 g/mol. Its IUPAC name is (4-methylidene-5-oxooxolan-2-yl)methyl 2,2,4,4-tetramethylpentanoate.
| Compound Name | (4-methylidene-5-oxooxolan-2-yl)methyl 2,2,4,4-tetramethylpentanoate |
|---|---|
| PubChem CID | 163662922 |
| Molecular Formula | C15H24O4 |
| Molecular Weight | 268.35 g/mol |
| Exact Mass | 268.17 |
| IUPAC Name | (4-methylidene-5-oxooxolan-2-yl)methyl 2,2,4,4-tetramethylpentanoate |
| SMILES | C=C1CC(COC(=O)C(C)(C)CC(C)(C)C)OC1=O |
| InChI | InChI=1S/C15H24O4/c1-10-7-11(19-12(10)16)8-18-13(17)15(5,6)9-14(2,3)4/h11H,1,7-9H2,2-6H3 |
| InChIKey | IVXSSNUCTLVPRL-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.35 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|