C9H14O4S — CID 147288997
(2-oxo-1,3-oxathiolan-5-yl)methyl 2,2-dimethylpropanoate (PubChem CID 147288997) has the molecular formula C9H14O4S and a molecular weight of 218.27 g/mol. Its IUPAC name is (2-oxo-1,3-oxathiolan-5-yl)methyl 2,2-dimethylpropanoate.
| Compound Name | (2-oxo-1,3-oxathiolan-5-yl)methyl 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 147288997 |
| Molecular Formula | C9H14O4S |
| Molecular Weight | 218.27 g/mol |
| Exact Mass | 218.06 |
| IUPAC Name | (2-oxo-1,3-oxathiolan-5-yl)methyl 2,2-dimethylpropanoate |
| SMILES | CC(C)(C)C(=O)OCC1CSC(=O)O1 |
| InChI | InChI=1S/C9H14O4S/c1-9(2,3)7(10)12-4-6-5-14-8(11)13-6/h6H,4-5H2,1-3H3 |
| InChIKey | CTUREBSDXYNMOJ-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.27 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|