C18H19N3O3 — CID 163666877
2-[3-(4,5-dihydrobenzotriazol-2-yl)-4-hydroxyphenyl]ethyl 2-methylprop-2-enoate (PubChem CID 163666877) has the molecular formula C18H19N3O3 and a molecular weight of 325.37 g/mol. Its IUPAC name is 2-[3-(4,5-dihydrobenzotriazol-2-yl)-4-hydroxyphenyl]ethyl 2-methylprop-2-enoate.
| Compound Name | 2-[3-(4,5-dihydrobenzotriazol-2-yl)-4-hydroxyphenyl]ethyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 163666877 |
| Molecular Formula | C18H19N3O3 |
| Molecular Weight | 325.37 g/mol |
| Exact Mass | 325.14 |
| IUPAC Name | 2-[3-(4,5-dihydrobenzotriazol-2-yl)-4-hydroxyphenyl]ethyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCc1ccc(O)c(-n2nc3c(n2)CCC=C3)c1 |
| InChI | InChI=1S/C18H19N3O3/c1-12(2)18(23)24-10-9-13-7-8-17(22)16(11-13)21-19-14-5-3-4-6-15(14)20-21/h3,5,7-8,11,22H,1,4,6,9-10H2,2H3 |
| InChIKey | IZFQOLDTSPUMGN-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.37 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|