C11H11NS2 — CID 163666997
4-propylisoindole-1,3-dithione (PubChem CID 163666997) has the molecular formula C11H11NS2 and a molecular weight of 221.35 g/mol. Its IUPAC name is 4-propylisoindole-1,3-dithione.
| Compound Name | 4-propylisoindole-1,3-dithione |
|---|---|
| PubChem CID | 163666997 |
| Molecular Formula | C11H11NS2 |
| Molecular Weight | 221.35 g/mol |
| Exact Mass | 221.03 |
| IUPAC Name | 4-propylisoindole-1,3-dithione |
| SMILES | CCCc1cccc2c1C(=S)NC2=S |
| InChI | InChI=1S/C11H11NS2/c1-2-4-7-5-3-6-8-9(7)11(14)12-10(8)13/h3,5-6H,2,4H2,1H3,(H,12,13,14) |
| InChIKey | IZIBITKKVKWKKU-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.35 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|