C16H17NO2 — CID 176954774
(4E)-2-methyl-4-prop-2-enylidene-5-propylisoquinoline-1,3-dione (PubChem CID 176954774) has the molecular formula C16H17NO2 and a molecular weight of 255.32 g/mol. Its IUPAC name is (4E)-2-methyl-4-prop-2-enylidene-5-propylisoquinoline-1,3-dione.
| Compound Name | (4E)-2-methyl-4-prop-2-enylidene-5-propylisoquinoline-1,3-dione |
|---|---|
| PubChem CID | 176954774 |
| Molecular Formula | C16H17NO2 |
| Molecular Weight | 255.32 g/mol |
| Exact Mass | 255.13 |
| IUPAC Name | (4E)-2-methyl-4-prop-2-enylidene-5-propylisoquinoline-1,3-dione |
| SMILES | C=C/C=C1/C(=O)N(C)C(=O)c2cccc(CCC)c21 |
| InChI | InChI=1S/C16H17NO2/c1-4-7-11-9-6-10-13-14(11)12(8-5-2)15(18)17(3)16(13)19/h5-6,8-10H,2,4,7H2,1,3H3/b12-8+ |
| InChIKey | DMABGEJOFDZKFF-XYOKQWHBSA-N |
| XLogP | 2.82 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.32 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|