C13H11NO2 — CID 142370923
4-ethenyl-2-methyl-5-methylideneisoquinoline-1,3-dione (PubChem CID 142370923) has the molecular formula C13H11NO2 and a molecular weight of 213.24 g/mol. Its IUPAC name is 4-ethenyl-2-methyl-5-methylideneisoquinoline-1,3-dione.
| Compound Name | 4-ethenyl-2-methyl-5-methylideneisoquinoline-1,3-dione |
|---|---|
| PubChem CID | 142370923 |
| Molecular Formula | C13H11NO2 |
| Molecular Weight | 213.24 g/mol |
| Exact Mass | 213.08 |
| IUPAC Name | 4-ethenyl-2-methyl-5-methylideneisoquinoline-1,3-dione |
| SMILES | C=CC1=c2c(cccc2=C)C(=O)N(C)C1=O |
| InChI | InChI=1S/C13H11NO2/c1-4-9-11-8(2)6-5-7-10(11)13(16)14(3)12(9)15/h4-7H,1-2H2,3H3 |
| InChIKey | UPGCVGJWJCCQMY-UHFFFAOYSA-N |
| XLogP | 0.05 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.24 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|