C8H14N2O — CID 163668282
(4R)-2,4-diamino-3,4-dimethylcyclohex-2-en-1-one (PubChem CID 163668282) has the molecular formula C8H14N2O and a molecular weight of 154.21 g/mol. Its IUPAC name is (4R)-2,4-diamino-3,4-dimethylcyclohex-2-en-1-one.
| Compound Name | (4R)-2,4-diamino-3,4-dimethylcyclohex-2-en-1-one |
|---|---|
| PubChem CID | 163668282 |
| Molecular Formula | C8H14N2O |
| Molecular Weight | 154.21 g/mol |
| Exact Mass | 154.11 |
| IUPAC Name | (4R)-2,4-diamino-3,4-dimethylcyclohex-2-en-1-one |
| SMILES | CC1=C(N)C(=O)CC[C@@]1(C)N |
| InChI | InChI=1S/C8H14N2O/c1-5-7(9)6(11)3-4-8(5,2)10/h3-4,9-10H2,1-2H3/t8-/m1/s1 |
| InChIKey | JAIFZSXJVCDNCC-MRVPVSSYSA-N |
| XLogP | 0.30 |
| TPSA | 69.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.21 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |