About 2-amino-3-hydroxy-4,4-dimethylcyclopent-2-en-1-one
2-amino-3-hydroxy-4,4-dimethylcyclopent-2-en-1-one (PubChem CID 20726508) has the molecular formula C7H11NO2
and a molecular weight of 141.17 g/mol. Its IUPAC name is 2-amino-3-hydroxy-4,4-dimethylcyclopent-2-en-1-one.
Analyze 2-amino-3-hydroxy-4,4-dimethylcyclopent-2-en-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-3-hydroxy-4,4-dimethylcyclopent-2-en-1-one?
The IUPAC name of 2-amino-3-hydroxy-4,4-dimethylcyclopent-2-en-1-one (CID 20726508) is 2-amino-3-hydroxy-4,4-dimethylcyclopent-2-en-1-one.
What is the SMILES notation for 2-amino-3-hydroxy-4,4-dimethylcyclopent-2-en-1-one?
The canonical SMILES for 2-amino-3-hydroxy-4,4-dimethylcyclopent-2-en-1-one is CC1(C)CC(=O)C(N)=C1O.
What is the InChIKey of 2-amino-3-hydroxy-4,4-dimethylcyclopent-2-en-1-one?
The InChIKey is SJWIYWWRNGORTO-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11NO2/c1-7(2)3-4(9)5(8)6(7)10/h10H,3,8H2,1-2H3.
What are the key properties of 2-amino-3-hydroxy-4,4-dimethylcyclopent-2-en-1-one?
2-amino-3-hydroxy-4,4-dimethylcyclopent-2-en-1-one has a molecular weight of 141.17 g/mol, XLogP of 0.71, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-3-hydroxy-4,4-dimethylcyclopent-2-en-1-one is sourced from PubChem (CID 20726508), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).