C15H19NO4 — CID 163669562
[(3aR,6R)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] N-(4-ethylphenyl)carbamate (PubChem CID 163669562) has the molecular formula C15H19NO4 and a molecular weight of 277.32 g/mol. Its IUPAC name is [(3aR,6R)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] N-(4-ethylphenyl)carbamate.
| Compound Name | [(3aR,6R)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] N-(4-ethylphenyl)carbamate |
|---|---|
| PubChem CID | 163669562 |
| Molecular Formula | C15H19NO4 |
| Molecular Weight | 277.32 g/mol |
| Exact Mass | 277.13 |
| IUPAC Name | [(3aR,6R)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] N-(4-ethylphenyl)carbamate |
| SMILES | CCc1ccc(NC(=O)O[C@@H]2CO[C@@H]3CCOC32)cc1 |
| InChI | InChI=1S/C15H19NO4/c1-2-10-3-5-11(6-4-10)16-15(17)20-13-9-19-12-7-8-18-14(12)13/h3-6,12-14H,2,7-9H2,1H3,(H,16,17)/t12-,13-,14?/m1/s1 |
| InChIKey | JBIHMHFBWLOPAM-ZFXTZCCVSA-N |
| XLogP | 2.35 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.32 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |