C15H21F2N2O4P — CID 163671548
3-[(2,4-difluorophenyl)methoxy]-2-[[2-methyl-2-(methylphosphanylamino)propanoyl]amino]propanoic acid (PubChem CID 163671548) has the molecular formula C15H21F2N2O4P and a molecular weight of 362.31 g/mol. Its IUPAC name is 3-[(2,4-difluorophenyl)methoxy]-2-[[2-methyl-2-(methylphosphanylamino)propanoyl]amino]propanoic acid.
| Compound Name | 3-[(2,4-difluorophenyl)methoxy]-2-[[2-methyl-2-(methylphosphanylamino)propanoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 163671548 |
| Molecular Formula | C15H21F2N2O4P |
| Molecular Weight | 362.31 g/mol |
| Exact Mass | 362.12 |
| IUPAC Name | 3-[(2,4-difluorophenyl)methoxy]-2-[[2-methyl-2-(methylphosphanylamino)propanoyl]amino]propanoic acid |
| SMILES | CPNC(C)(C)C(=O)NC(COCc1ccc(F)cc1F)C(=O)O |
| InChI | InChI=1S/C15H21F2N2O4P/c1-15(2,19-24-3)14(22)18-12(13(20)21)8-23-7-9-4-5-10(16)6-11(9)17/h4-6,12,19,24H,7-8H2,1-3H3,(H,18,22)(H,20,21) |
| InChIKey | JCZUAYDBBSTMRC-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.31 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|