C7H16N2 — CID 163674101
4-imino-N,N-dimethylpentan-2-amine (PubChem CID 163674101) has the molecular formula C7H16N2 and a molecular weight of 128.22 g/mol. Its IUPAC name is 4-imino-N,N-dimethylpentan-2-amine.
| Compound Name | 4-imino-N,N-dimethylpentan-2-amine |
|---|---|
| PubChem CID | 163674101 |
| Molecular Formula | C7H16N2 |
| Molecular Weight | 128.22 g/mol |
| Exact Mass | 128.13 |
| IUPAC Name | 4-imino-N,N-dimethylpentan-2-amine |
| SMILES | [H]/N=C(\C)CC(C)N(C)C |
| InChI | InChI=1S/C7H16N2/c1-6(8)5-7(2)9(3)4/h7-8H,5H2,1-4H3/b8-6+ |
| InChIKey | JFCYXKWZTJALRZ-SOFGYWHQSA-N |
| XLogP | 1.37 |
| TPSA | 27.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 128.22 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|