C30H30FN7O2 — CID 163675714
2-[[4-(6-fluoro-2-pyridinyl)phenyl]methyl]-3-(2-hydroxyanilino)-5-methyl-6-[[(1R,2S)-2-methylcyclopentyl]amino]pyrazolo[3,4-d]pyrimidin-4-one (PubChem CID 163675714) has the molecular formula C30H30FN7O2 and a molecular weight of 539.62 g/mol. Its IUPAC name is 2-[[4-(6-fluoro-2-pyridinyl)phenyl]methyl]-3-(2-hydroxyanilino)-5-methyl-6-[[(1R,2S)-2-methylcyclopentyl]amino]pyrazolo[3,4-d]pyrimidin-4-one.
| Compound Name | 2-[[4-(6-fluoro-2-pyridinyl)phenyl]methyl]-3-(2-hydroxyanilino)-5-methyl-6-[[(1R,2S)-2-methylcyclopentyl]amino]pyrazolo[3,4-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 163675714 |
| Molecular Formula | C30H30FN7O2 |
| Molecular Weight | 539.62 g/mol |
| Exact Mass | 539.24 |
| IUPAC Name | 2-[[4-(6-fluoro-2-pyridinyl)phenyl]methyl]-3-(2-hydroxyanilino)-5-methyl-6-[[(1R,2S)-2-methylcyclopentyl]amino]pyrazolo[3,4-d]pyrimidin-4-one |
| SMILES | C[C@H]1CCC[C@H]1Nc1nc2nn(Cc3ccc(-c4cccc(F)n4)cc3)c(Nc3ccccc3O)c2c(=O)n1C |
| InChI | InChI=1S/C30H30FN7O2/c1-18-7-5-9-21(18)34-30-35-27-26(29(40)37(30)2)28(33-23-8-3-4-11-24(23)39)38(36-27)17-19-13-15-20(16-14-19)22-10-6-12-25(31)32-22/h3-4,6,8,10-16,18,21,33,39H,5,7,9,17H2,1-2H3,(H,34,35,36)/t18-,21+/m0/s1 |
| InChIKey | JGNDYNQSMQOPKG-GHTZIAJQSA-N |
| XLogP | 5.43 |
| TPSA | 109.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.62 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|