C7H11NO4 — CID 163676443
(1R)-1-[(2S,3R)-3-(nitrosomethyl)oxiran-2-yl]but-3-ene-1,3-diol (PubChem CID 163676443) has the molecular formula C7H11NO4 and a molecular weight of 173.17 g/mol. Its IUPAC name is (1R)-1-[(2S,3R)-3-(nitrosomethyl)oxiran-2-yl]but-3-ene-1,3-diol.
| Compound Name | (1R)-1-[(2S,3R)-3-(nitrosomethyl)oxiran-2-yl]but-3-ene-1,3-diol |
|---|---|
| PubChem CID | 163676443 |
| Molecular Formula | C7H11NO4 |
| Molecular Weight | 173.17 g/mol |
| Exact Mass | 173.07 |
| IUPAC Name | (1R)-1-[(2S,3R)-3-(nitrosomethyl)oxiran-2-yl]but-3-ene-1,3-diol |
| SMILES | C=C(O)C[C@@H](O)[C@@H]1O[C@@H]1CN=O |
| InChI | InChI=1S/C7H11NO4/c1-4(9)2-5(10)7-6(12-7)3-8-11/h5-7,9-10H,1-3H2/t5-,6-,7+/m1/s1 |
| InChIKey | JHCNGQUAATZPLX-QYNIQEEDSA-N |
| XLogP | 0.34 |
| TPSA | 82.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.17 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|