C6H12N2O5 — CID 143285152
2-amino-6-(nitrosomethyl)oxane-3,4,5-triol (PubChem CID 143285152) has the molecular formula C6H12N2O5 and a molecular weight of 192.17 g/mol. Its IUPAC name is 2-amino-6-(nitrosomethyl)oxane-3,4,5-triol.
| Compound Name | 2-amino-6-(nitrosomethyl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 143285152 |
| Molecular Formula | C6H12N2O5 |
| Molecular Weight | 192.17 g/mol |
| Exact Mass | 192.07 |
| IUPAC Name | 2-amino-6-(nitrosomethyl)oxane-3,4,5-triol |
| SMILES | NC1OC(CN=O)C(O)C(O)C1O |
| InChI | InChI=1S/C6H12N2O5/c7-6-5(11)4(10)3(9)2(13-6)1-8-12/h2-6,9-11H,1,7H2 |
| InChIKey | PSQPIROEYHQZKZ-UHFFFAOYSA-N |
| XLogP | -2.48 |
| TPSA | 125.37 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.17 |
| LogP ≤ 5 | -2.48 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |