C55H37FN4 — CID 163679921
3-[(1Z)-buta-1,3-dienyl]-2-[4-[4-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]naphthalen-1-yl]phenyl]-7-fluoro-4-methylacridine (PubChem CID 163679921) has the molecular formula C55H37FN4 and a molecular weight of 772.93 g/mol. Its IUPAC name is 3-[(1Z)-buta-1,3-dienyl]-2-[4-[4-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]naphthalen-1-yl]phenyl]-7-fluoro-4-methylacridine.
| Compound Name | 3-[(1Z)-buta-1,3-dienyl]-2-[4-[4-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]naphthalen-1-yl]phenyl]-7-fluoro-4-methylacridine |
|---|---|
| PubChem CID | 163679921 |
| Molecular Formula | C55H37FN4 |
| Molecular Weight | 772.93 g/mol |
| Exact Mass | 772.30 |
| IUPAC Name | 3-[(1Z)-buta-1,3-dienyl]-2-[4-[4-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]naphthalen-1-yl]phenyl]-7-fluoro-4-methylacridine |
| SMILES | C=C/C=C\c1c(-c2ccc(-c3ccc(-c4ccc(-c5nc(-c6ccccc6)nc(-c6ccccc6)n5)cc4)c4ccccc34)cc2)cc2cc3cc(F)ccc3nc2c1C |
| InChI | InChI=1S/C55H37FN4/c1-3-4-17-45-35(2)52-43(32-42-33-44(56)28-31-51(42)57-52)34-50(45)38-22-20-36(21-23-38)46-29-30-47(49-19-12-11-18-48(46)49)37-24-26-41(27-25-37)55-59-53(39-13-7-5-8-14-39)58-54(60-55)40-15-9-6-10-16-40/h3-34H,1H2,2H3/b17-4- |
| InChIKey | JJYSKBGFVHCZHU-INGKJJEOSA-N |
| XLogP | 14.37 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 772.93 |
| LogP ≤ 5 | 14.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|