C24H23ClN2O4 — CID 163683861
[2-(3-chloro-4-methylanilino)-2-hydroxy-1-phenylethyl] 4-acetamidobenzoate (PubChem CID 163683861) has the molecular formula C24H23ClN2O4 and a molecular weight of 438.91 g/mol. Its IUPAC name is [2-(3-chloro-4-methylanilino)-2-hydroxy-1-phenylethyl] 4-acetamidobenzoate.
| Compound Name | [2-(3-chloro-4-methylanilino)-2-hydroxy-1-phenylethyl] 4-acetamidobenzoate |
|---|---|
| PubChem CID | 163683861 |
| Molecular Formula | C24H23ClN2O4 |
| Molecular Weight | 438.91 g/mol |
| Exact Mass | 438.13 |
| IUPAC Name | [2-(3-chloro-4-methylanilino)-2-hydroxy-1-phenylethyl] 4-acetamidobenzoate |
| SMILES | CC(=O)Nc1ccc(C(=O)OC(c2ccccc2)C(O)Nc2ccc(C)c(Cl)c2)cc1 |
| InChI | InChI=1S/C24H23ClN2O4/c1-15-8-11-20(14-21(15)25)27-23(29)22(17-6-4-3-5-7-17)31-24(30)18-9-12-19(13-10-18)26-16(2)28/h3-14,22-23,27,29H,1-2H3,(H,26,28) |
| InChIKey | JNCNUKNPLRHBES-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.91 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|