C21H42N2O3 — CID 163686516
(2S)-2-[[(2R)-2-[2-hydroxy-2-[(2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxyethyl]pentyl]amino]butanamide (PubChem CID 163686516) has the molecular formula C21H42N2O3 and a molecular weight of 370.58 g/mol. Its IUPAC name is (2S)-2-[[(2R)-2-[2-hydroxy-2-[(2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxyethyl]pentyl]amino]butanamide.
| Compound Name | (2S)-2-[[(2R)-2-[2-hydroxy-2-[(2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxyethyl]pentyl]amino]butanamide |
|---|---|
| PubChem CID | 163686516 |
| Molecular Formula | C21H42N2O3 |
| Molecular Weight | 370.58 g/mol |
| Exact Mass | 370.32 |
| IUPAC Name | (2S)-2-[[(2R)-2-[2-hydroxy-2-[(2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxyethyl]pentyl]amino]butanamide |
| SMILES | CCC[C@@H](CN[C@@H](CC)C(N)=O)CC(O)OC1C[C@H](C)CC[C@H]1C(C)C |
| InChI | InChI=1S/C21H42N2O3/c1-6-8-16(13-23-18(7-2)21(22)25)12-20(24)26-19-11-15(5)9-10-17(19)14(3)4/h14-20,23-24H,6-13H2,1-5H3,(H2,22,25)/t15-,16-,17+,18+,19?,20?/m1/s1 |
| InChIKey | JPICQSXDDYBYDZ-DKQUAYRMSA-N |
| XLogP | 3.44 |
| TPSA | 84.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.58 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|