C22H44Cl2N2O2 — CID 175197700
2-[(10-amino-1,10-dichlorodecyl)amino]-1-(5-methyl-2-propan-2-ylcyclohexyl)oxyethanol (PubChem CID 175197700) has the molecular formula C22H44Cl2N2O2 and a molecular weight of 439.51 g/mol. Its IUPAC name is 2-[(10-amino-1,10-dichlorodecyl)amino]-1-(5-methyl-2-propan-2-ylcyclohexyl)oxyethanol.
| Compound Name | 2-[(10-amino-1,10-dichlorodecyl)amino]-1-(5-methyl-2-propan-2-ylcyclohexyl)oxyethanol |
|---|---|
| PubChem CID | 175197700 |
| Molecular Formula | C22H44Cl2N2O2 |
| Molecular Weight | 439.51 g/mol |
| Exact Mass | 438.28 |
| IUPAC Name | 2-[(10-amino-1,10-dichlorodecyl)amino]-1-(5-methyl-2-propan-2-ylcyclohexyl)oxyethanol |
| SMILES | CC1CCC(C(C)C)C(OC(O)CNC(Cl)CCCCCCCCC(N)Cl)C1 |
| InChI | InChI=1S/C22H44Cl2N2O2/c1-16(2)18-13-12-17(3)14-19(18)28-22(27)15-26-21(24)11-9-7-5-4-6-8-10-20(23)25/h16-22,26-27H,4-15,25H2,1-3H3 |
| InChIKey | YQHYUGOKBRWUQK-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 67.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.51 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|