C19H36O4 — CID 147293424
4-[3-hydroxy-3-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxypropyl]cyclohexane-1,3-diol (PubChem CID 147293424) has the molecular formula C19H36O4 and a molecular weight of 328.49 g/mol. Its IUPAC name is 4-[3-hydroxy-3-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxypropyl]cyclohexane-1,3-diol.
| Compound Name | 4-[3-hydroxy-3-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxypropyl]cyclohexane-1,3-diol |
|---|---|
| PubChem CID | 147293424 |
| Molecular Formula | C19H36O4 |
| Molecular Weight | 328.49 g/mol |
| Exact Mass | 328.26 |
| IUPAC Name | 4-[3-hydroxy-3-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxypropyl]cyclohexane-1,3-diol |
| SMILES | CC(C)[C@@H]1CC[C@@H](C)C[C@H]1OC(O)CCC1CCC(O)CC1O |
| InChI | InChI=1S/C19H36O4/c1-12(2)16-8-4-13(3)10-18(16)23-19(22)9-6-14-5-7-15(20)11-17(14)21/h12-22H,4-11H2,1-3H3/t13-,14?,15?,16+,17?,18-,19?/m1/s1 |
| InChIKey | CUQNSOIGRFZFJH-OXXYZVFYSA-N |
| XLogP | 3.08 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.49 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|