C23H27Cl2N3O — CID 163689750
(1S,4S)-7-[C-(2-aminoethenyl)-N-(ethoxymethyl)carbonimidoyl]-4-(3,4-dichlorophenyl)-N-methyl-1,2,3,4-tetrahydronaphthalen-1-amine (PubChem CID 163689750) has the molecular formula C23H27Cl2N3O and a molecular weight of 432.40 g/mol. Its IUPAC name is (1S,4S)-7-[C-(2-aminoethenyl)-N-(ethoxymethyl)carbonimidoyl]-4-(3,4-dichlorophenyl)-N-methyl-1,2,3,4-tetrahydronaphthalen-1-amine.
| Compound Name | (1S,4S)-7-[C-(2-aminoethenyl)-N-(ethoxymethyl)carbonimidoyl]-4-(3,4-dichlorophenyl)-N-methyl-1,2,3,4-tetrahydronaphthalen-1-amine |
|---|---|
| PubChem CID | 163689750 |
| Molecular Formula | C23H27Cl2N3O |
| Molecular Weight | 432.40 g/mol |
| Exact Mass | 431.15 |
| IUPAC Name | (1S,4S)-7-[C-(2-aminoethenyl)-N-(ethoxymethyl)carbonimidoyl]-4-(3,4-dichlorophenyl)-N-methyl-1,2,3,4-tetrahydronaphthalen-1-amine |
| SMILES | CCOCN=C(C=CN)c1ccc2c(c1)[C@@H](NC)CC[C@H]2c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C23H27Cl2N3O/c1-3-29-14-28-22(10-11-26)16-4-6-18-17(7-9-23(27-2)19(18)12-16)15-5-8-20(24)21(25)13-15/h4-6,8,10-13,17,23,27H,3,7,9,14,26H2,1-2H3/t17-,23-/m0/s1 |
| InChIKey | VYQACIGLXUXVSK-SBUREZEXSA-N |
| XLogP | 5.44 |
| TPSA | 59.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.40 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|